2-Mercaptoethanol-d6 [203645-37-8]
Référence HY-W739065-25mg
Conditionnement : 25mg
Marque : MedChemExpress
| Description |
2-Mercaptoethanol-d6 is deuterium labeled 2-Mercaptoethanol[1]. |
|---|---|
| Application |
1. This compound can be used as a tracer. |
| Masse moléculaire |
84.17 |
| Formule |
C2D6OS |
| CAS No. | |
| Unlabeled CAS | |
| Appearance |
Liquid (Density: 1.069±0.06 g/cm3) |
| Color |
Colorless to light yellow |
| SMILES |
[2H]C(C([2H])(S[2H])[2H])(O[2H])[2H] |
| Livraison | Room temperature in continental US; may vary elsewhere. |
| Stockage |
Please store the product under the recommended conditions in the Certificate of Analysis. |
| Pureté et documentation | |
| Références |

