TCEP-D16 hydrochloride [1174025-33-2]
Référence TMID-0352-10mg
Conditionnement : 10mg
Marque : TargetMol
TCEP-D16 hydrochloride
Copy Product InfoTCEP-D16 hydrochloride is the deuterated form of TCEP hydrochloride. TCEP hydrochloride (T7087) [Tris (2-carboxyethyl)phosphine hydrochloride] is a non-thiol reducing agent that offers greater stability and induces faster S-S bond reduction compared to other chemical reducing agents. As a trialkylphosphine, it selectively reduces protein degradation without altering their characteristics or interacting with thiol-directing agents in the reaction mixture. Additionally, TCEP hydrochloride (T7087) is frequently used as a reducing agent in DNA/AuNP chemistry.
Product Introduction
Bioactivity
Chemical Properties
Storage & Solubility Information
| Description | TCEP-D16 hydrochloride is the deuterated form of TCEP hydrochloride. TCEP hydrochloride (T7087) [Tris (2-carboxyethyl)phosphine hydrochloride] is a non-thiol reducing agent that offers greater stability and induces faster S-S bond reduction compared to other chemical reducing agents. As a trialkylphosphine, it selectively reduces protein degradation without altering their characteristics or interacting with thiol-directing agents in the reaction mixture. Additionally, TCEP hydrochloride (T7087) is frequently used as a reducing agent in DNA/AuNP chemistry. |
| Molecular Weight | 302.75 |
| Formula | C9H16ClO6P |
| Cas No. | 1174025-33-2 |
| Smiles | P(C(C(C(O[2H])=O)([2H])[2H])([2H])[2H])(C(C(C(O[2H])=O)([2H])[2H])([2H])[2H])C(C(C(O[2H])=O)([2H])[2H])([2H])[2H].Cl[2H] |
| Storage | Powder: -20°C for 3 years | In solvent: -80°C for 1 year Shipping with blue ice/Shipping at ambient temperature. |


