Amphotericin B [1397-89-3]
Référence A10073-100
Conditionnement : 100mg
Marque : Adooq Bioscience
Product Information
| Catalog Num | A10073 |
|---|---|
| Formula | C47H73NO17 |
| Molecular Weight | 924.1 |
| CAS Number | 1397-89-3 |
| SMILES | C[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](CC(=O)O[C@H]([C@@H]([C@@H]1O)C)C)O)O)O)O)O)O)O)C(=O)O)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)C)O)N)O |
| Synonyms | Fungilin, Fungizone, AmBisome, Fungisome, Amphocil, Amphotec |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
Solubility
| In vitro | DMSO | 20 mg/mL (21.64 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
Preparing Stock Solutions
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 10.82 mL | 54.11 mL | 108.21 mL |
| 0.5 mM | 2.16 mL | 10.82 mL | 21.64 mL |
| 1 mM | 1.08 mL | 5.41 mL | 10.82 mL |
| 5 mM | 0.22 mL | 1.08 mL | 2.16 mL |

