2-Mercaptoethanol-d6 [203645-37-8]
Katalog-Nummer HY-W739065-100mg
Size : 100mg
Marke : MedChemExpress
| Beschreibung |
2-Mercaptoethanol-d6 is deuterium labeled 2-Mercaptoethanol[1]. |
||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Application |
1. This compound can be used as a tracer. |
||||||||||||
| Molekulargewicht |
84.17 |
||||||||||||
| Formel |
C2D6OS |
||||||||||||
| CAS. Nr. | |||||||||||||
| Unlabeled CAS | |||||||||||||
| Appearance |
Liquid (Density: 1.069±0.06 g/cm3) |
||||||||||||
| Color |
Colorless to light yellow |
||||||||||||
| SMILES |
[2H]C(C([2H])(S[2H])[2H])(O[2H])[2H] |
||||||||||||
| Versand | Room temperature in continental US; may vary elsewhere. |
||||||||||||
| Speicherung |
|
||||||||||||
| Reinheit & Dokumentation | |||||||||||||
| Verweise |

