Dicamba 1-azidopropane [2892008-32-9]
Referencia HY-163014
embalaje : Onrequest
Marca : MedChemExpress
| Descripciòn |
Dicamba 1-azidopropane (DCn) is an immunizing and heterologous hapten. Dicamba 1-azidopropane can be used to generate monoclonal antibodies specific of Dicamba[1]. |
|---|---|
| Peso molecular |
304.13 |
| Fòrmula |
C11H11Cl2N3O3 |
| No. CAS | |
| SMILES |
[N-]=[N+]=NCCCC1=CC(Cl)=C(C(C(O)=O)=C1Cl)OC |
| Envío | Room temperature in continental US; may vary elsewhere. |
| Almacenamiento |
Please store the product under the recommended conditions in the Certificate of Analysis. |
| Pureza y Documentación | |
| Referencias |

