D-Melibiose [585-99-9]
Cat# A17414-500
Size : 500mg
Marca : Adooq Bioscience
Product Information
| Catalog Num | A17414 |
|---|---|
| Formula | C12H22O11 |
| Molecular Weight | 342.3 |
| CAS Number | 585-99-9 |
| SMILES | O=C[C@@H]([C@H]([C@@H]([C@@H](CO[C@@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
Solubility
| In vitro | DMSO | 66 mg/mL (192.81 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
Preparing Stock Solutions
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.21 mL | 146.07 mL | 292.14 mL |
| 0.5 mM | 5.84 mL | 29.21 mL | 58.43 mL |
| 1 mM | 2.92 mL | 14.61 mL | 29.21 mL |
| 5 mM | 0.58 mL | 2.92 mL | 5.84 mL |

