Aristolochic acid Va [108779-46-0]
Referentie HY-N11445-5mg
Formaat : 5mg
Merk : MedChemExpress
| Description | |
|---|---|
| Masse moléculaire |
357.27 |
| Formule |
C17H11NO8 |
| CAS No. | |
| Appearance |
Solid |
| Color |
Light yellow to yellow |
| SMILES |
O=C(C1=CC2=C(C3=C1C([N+]([O-])=O)=CC4=CC(OC)=C(O)C=C34)OCO2)O |
| Structure Classification | |
| Initial Source | |
| Livraison | Room temperature in continental US; may vary elsewhere. |
| Stockage |
4°C, sealed storage, away from moisture and light *In solvent : -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Pureté et documentation | |
| Références |

