2-Mercaptoethanol-d6 [203645-37-8]
Referentie HY-W739065-1mg
Formaat : 1mg
Merk : MedChemExpress
| Description |
2-Mercaptoethanol-d6 is deuterium labeled 2-Mercaptoethanol[1]. |
||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Application |
1. This compound can be used as a tracer. |
||||||||||||
| Masse moléculaire |
84.17 |
||||||||||||
| Formule |
C2D6OS |
||||||||||||
| CAS No. | |||||||||||||
| Unlabeled CAS | |||||||||||||
| Appearance |
Liquid (Density: 1.069±0.06 g/cm3) |
||||||||||||
| Color |
Colorless to light yellow |
||||||||||||
| SMILES |
[2H]C(C([2H])(S[2H])[2H])(O[2H])[2H] |
||||||||||||
| Livraison | Room temperature in continental US; may vary elsewhere. |
||||||||||||
| Stockage |
|
||||||||||||
| Pureté et documentation | |||||||||||||
| Références |

