(+)-β-Pinene [19902-08-0]
Referencia HY-W716339-1mL
embalaje : 1mL
Marca : MedChemExpress
| Descripciòn |
(+)-β-Pinene is an enantiomer of a (-)-β-pinene. (+)-β-pinene has antifungal activity and most likely acts through interference with the cell wall; |
|---|---|
| Peso molecular |
136.23 |
| Fòrmula |
C10H16 |
| No. CAS | |
| SMILES |
CC1([C@@H]2C[C@H]1CCC2=C)C |
| Structure Classification | |
| Initial Source | |
| Envío | Room temperature in continental US; may vary elsewhere. |
| Almacenamiento |
Please store the product under the recommended conditions in the Certificate of Analysis. |
| Pureza y Documentación | |
| Referencias |

