2α-Mannobiose [15548-39-7]
Referencia HY-121735-10mg
embalaje : 10mg
Marca : MedChemExpress
| Descripciòn |
2α-Mannobiose is a disaccharide composed of two mannose molecules linked by a 1-2 glycosidic bond. 2α-Mannobiose can be used for affinity purification of mannose-binding proteins by column chromatography[1]. |
|---|---|
| Peso molecular |
342.30 |
| Fòrmula |
C12H22O11 |
| No. CAS | |
| SMILES |
OC[C@H]1OC(O)[C@@H](O[C@@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O2)[C@@H](O)[C@@H]1O |
| Envío | Room temperature in continental US; may vary elsewhere. |
| Almacenamiento |
Please store the product under the recommended conditions in the Certificate of Analysis. |
| Pureza y Documentación | |
| Referencias |
|

