Carmine (lithium) [12772-56-4]
Referencia HY-127154
embalaje : Onrequest
Marca : MedChemExpress
| Descripciòn |
Carmine lithium is a natural red colorant, which belongs to the coccid dye family[1]. |
|---|---|
| Peso molecular |
498.32 |
| Fòrmula |
C22H19LiO13 |
| No. CAS | |
| SMILES |
O=C1C2=C(O)C([C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO[Li])=C(O)C(O)=C2C(C4=CC(O)=C(C(O)=O)C(C)=C41)=O |
| Envío | Room temperature in continental US; may vary elsewhere. |
| Almacenamiento |
Please store the product under the recommended conditions in the Certificate of Analysis. |
| Pureza y Documentación | |
| Referencias |

