ddTTPαS [158705-77-2]
Referencia HY-137693
embalaje : Onrequest
Marca : MedChemExpress
| Descripciòn |
ddTTPαS is a sulfur-containing nucleoside triphosphate derivative. ddTTPαS can be used for chain extension in PCR assays[1]. |
|---|---|
| Peso molecular |
482.23 |
| Fòrmula |
C10H17N2O12P3S |
| No. CAS | |
| SMILES |
O=C(NC1=O)N(C=C1C)[C@](CC2)(13)O[C@@H]2CO[P](O[P](O[P](O)(O)=O)(O)=O)(S)=O |
| Envío | Room temperature in continental US; may vary elsewhere. |
| Almacenamiento |
Please store the product under the recommended conditions in the Certificate of Analysis. |
| Pureza y Documentación | |
| Referencias |

