Norepinephrine tartrate impurity 33 [636-88-4]
Referencia HY-W009184-500mg
embalaje : 500mg
Marca : MedChemExpress
| Descripciòn |
Norepinephrine tartrate impurity 33 is an impurity of Norepinephrine tartrate (HY-13715C). |
|---|---|
| Peso molecular |
319.27 |
| Fòrmula |
C12H17NO9 |
| No. CAS | |
| Appearance |
Solid |
| Color |
White to off-white |
| SMILES |
OC1=C(O)C=CC([C@@H](CN)O)=C1.OC([C@@H]([C@H](C(O)=O)O)O)=O |
| Envío | Room temperature in continental US; may vary elsewhere. |
| Almacenamiento |
4°C, protect from light, stored under nitrogen *In solvent : -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen) |
| Pureza y Documentación |

